Products 3030588-01-0
CAS 3030588-01-0 appears in our catalog under these names: NVS-STG2, 99.76%, NVS-STG2, 98%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 25 mg, 50 mg, 10 mg, 1 g, 5 mg, 100 mg, 10mM/1mL, 100mg.
4-[[4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)phenyl]methylamino]-3-methoxybenzoic acid (CAS 3030588-01-0) is a chemical compound with the molecular formula C25H33NO5 and a molecular weight of 427.5 g/mol. IUPAC name: 4-[[4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)phenyl]methylamino]-3-methoxybenzoic acid. InChIKey: CZSPKEVHLRWAFC-UHFFFAOYSA-N.
| Molecular formula | C25H33NO5 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | 4-[[4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)phenyl]methylamino]-3-methoxybenzoic acid |
| InChIKey | CZSPKEVHLRWAFC-UHFFFAOYSA-N |
| SMILES | CC1(COC(OC1)(C2=CC=C(C=C2)CNC3=C(C=C(C=C3)C(=O)O)OC)C(C)(C)C)C |
Computed by PubChem (NCBI)