CAS 303093-94-9 is the registry number for N-(4-Chlorophenyl)-N-(1,1-dioxidotetrahydrothiophen-3-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzamide (CAS 303093-94-9) is a chemical compound with the molecular formula C17H16ClNO3S and a molecular weight of 349.8 g/mol. IUPAC name: N-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzamide. InChIKey: MQXUUHIUTONJSA-UHFFFAOYSA-N.
| Molecular formula | C17H16ClNO3S |
|---|---|
| Molecular weight | 349.8 g/mol |
| IUPAC name | N-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzamide |
| InChIKey | MQXUUHIUTONJSA-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N(C2=CC=C(C=C2)Cl)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)