CAS 303094-04-4 is the registry number for 4-Chloro-N-(1,1-dioxido-2,3-dihydrothiophen-3-yl)-N-phenylbenzamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylbenzamide (CAS 303094-04-4) is a chemical compound with the molecular formula C17H14ClNO3S and a molecular weight of 347.8 g/mol. IUPAC name: 4-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylbenzamide. InChIKey: YDWZCQMAAZRWOG-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO3S |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | 4-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylbenzamide |
| InChIKey | YDWZCQMAAZRWOG-UHFFFAOYSA-N |
| SMILES | C1C(C=CS1(=O)=O)N(C2=CC=CC=C2)C(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)