CAS 3030990-46-3 is the registry number for Allyl-mannose-6-phosphonate. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-prop-2-enoxyoxan-2-yl]ethylphosphonic acid (CAS 3030990-46-3) is a chemical compound with the molecular formula C10H19O8P and a molecular weight of 298.23 g/mol. IUPAC name: 2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-prop-2-enoxyoxan-2-yl]ethylphosphonic acid. InChIKey: DCMNVGAAAFNMHS-ZJDVBMNYSA-N.
| Molecular formula | C10H19O8P |
|---|---|
| Molecular weight | 298.23 g/mol |
| IUPAC name | 2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-prop-2-enoxyoxan-2-yl]ethylphosphonic acid |
| InChIKey | DCMNVGAAAFNMHS-ZJDVBMNYSA-N |
| SMILES | C=CCO[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CCP(=O)(O)O)O)O)O |
Computed by PubChem (NCBI)