Products 303133-78-0

CAS 303133-78-0 is the registry number for 2-(((4,4,5,5,5-Pentafluoropentyl)oxy)carbonyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4,4,5,5,5-pentafluoropentoxycarbonyl)benzoic acid (CAS 303133-78-0) is a chemical compound with the molecular formula C13H11F5O4 and a molecular weight of 326.22 g/mol. IUPAC name: 2-(4,4,5,5,5-pentafluoropentoxycarbonyl)benzoic acid. InChIKey: UKGIEAZBRIUEFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11F5O4
Molecular weight326.22 g/mol
IUPAC name2-(4,4,5,5,5-pentafluoropentoxycarbonyl)benzoic acid
InChIKeyUKGIEAZBRIUEFZ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)C(=O)OCCCC(C(F)(F)F)(F)F

Computed by PubChem (NCBI)