CAS 303133-78-0 is the registry number for 2-(((4,4,5,5,5-Pentafluoropentyl)oxy)carbonyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,4,5,5,5-pentafluoropentoxycarbonyl)benzoic acid (CAS 303133-78-0) is a chemical compound with the molecular formula C13H11F5O4 and a molecular weight of 326.22 g/mol. IUPAC name: 2-(4,4,5,5,5-pentafluoropentoxycarbonyl)benzoic acid. InChIKey: UKGIEAZBRIUEFZ-UHFFFAOYSA-N.
| Molecular formula | C13H11F5O4 |
|---|---|
| Molecular weight | 326.22 g/mol |
| IUPAC name | 2-(4,4,5,5,5-pentafluoropentoxycarbonyl)benzoic acid |
| InChIKey | UKGIEAZBRIUEFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)OCCCC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)