CAS 303144-50-5 appears in our catalog under these names: 2-[5-(2-Fluorobenzoyl)-2-thienyl]acetonitrile, 2-[5-(2-Fluorobenzoyl)-2-thienyl]acetonitrile, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g.
2-[5-(2-fluorobenzoyl)thiophen-2-yl]acetonitrile (CAS 303144-50-5) is a chemical compound with the molecular formula C13H8FNOS and a molecular weight of 245.27 g/mol. IUPAC name: 2-[5-(2-fluorobenzoyl)thiophen-2-yl]acetonitrile. InChIKey: RLRKKMNSIAYGNS-UHFFFAOYSA-N.
| Molecular formula | C13H8FNOS |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 2-[5-(2-fluorobenzoyl)thiophen-2-yl]acetonitrile |
| InChIKey | RLRKKMNSIAYGNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(S2)CC#N)F |
Computed by PubChem (NCBI)