CAS 303145-65-5 is the registry number for 7-(4-Phenoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine 90%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-(4-phenoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (CAS 303145-65-5) is a chemical compound with the molecular formula C17H13N5O and a molecular weight of 303.32 g/mol. IUPAC name: 7-(4-phenoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine. InChIKey: MSWNBKBRRLSEKL-UHFFFAOYSA-N.
| Molecular formula | C17H13N5O |
|---|---|
| Molecular weight | 303.32 g/mol |
| IUPAC name | 7-(4-phenoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| InChIKey | MSWNBKBRRLSEKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C3=CC=NC4=NC(=NN34)N |
Computed by PubChem (NCBI)