CAS 303149-14-6 appears in our catalog under these names: HT-2157, 99+%, SNAP 37889, HT-2157/ 98.55% (existing batch purity), HT-2157 98+%, HT-2157, 98%, 98%. Offered by: AmBeed, TRC, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 100mg, 10mg, 25mg, 50mg, 1mg, 5 mg, 25 mg.
1-phenyl-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (CAS 303149-14-6) is a chemical compound with the molecular formula C21H13F3N2O and a molecular weight of 366.3 g/mol. IUPAC name: 1-phenyl-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one. InChIKey: TXCGMRVPXUBHAL-UHFFFAOYSA-N.
| Molecular formula | C21H13F3N2O |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 1-phenyl-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| InChIKey | TXCGMRVPXUBHAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3C(=NC4=CC=CC(=C4)C(F)(F)F)C2=O |
Computed by PubChem (NCBI)