CAS 3031580-91-0 is the registry number for SORT1-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-(3,4-dihydro-1H-isochromen-7-ylmethylamino)-5,5-dimethylhexanoic acid;methanesulfonic acid (CAS 3031580-91-0) is a chemical compound with the molecular formula C19H31NO6S and a molecular weight of 401.5 g/mol. IUPAC name: (2S)-2-(3,4-dihydro-1H-isochromen-7-ylmethylamino)-5,5-dimethylhexanoic acid;methanesulfonic acid. InChIKey: VUGMMENCKLCERU-NTISSMGPSA-N.
| Molecular formula | C19H31NO6S |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2S)-2-(3,4-dihydro-1H-isochromen-7-ylmethylamino)-5,5-dimethylhexanoic acid;methanesulfonic acid |
| InChIKey | VUGMMENCKLCERU-NTISSMGPSA-N |
| SMILES | CC(C)(C)CC[C@@H](C(=O)O)NCC1=CC2=C(CCOC2)C=C1.CS(=O)(=O)O |
Computed by PubChem (NCBI)