Products 3031612-93-5
CAS 3031612-93-5 is the registry number for AYK005. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-amino-9-benzyl-2-(1,1,1-trifluoropropan-2-yloxy)-7H-purin-8-one (CAS 3031612-93-5) is a chemical compound with the molecular formula C15H14F3N5O2 and a molecular weight of 353.30 g/mol. IUPAC name: 6-amino-9-benzyl-2-(1,1,1-trifluoropropan-2-yloxy)-7H-purin-8-one. InChIKey: KDEIFUZGOPBWPI-UHFFFAOYSA-N.
| Molecular formula | C15H14F3N5O2 |
|---|---|
| Molecular weight | 353.30 g/mol |
| IUPAC name | 6-amino-9-benzyl-2-(1,1,1-trifluoropropan-2-yloxy)-7H-purin-8-one |
| InChIKey | KDEIFUZGOPBWPI-UHFFFAOYSA-N |
| SMILES | CC(C(F)(F)F)OC1=NC(=C2C(=N1)N(C(=O)N2)CC3=CC=CC=C3)N |
Computed by PubChem (NCBI)