CAS 303175-44-2 appears in our catalog under these names: 2-(2-Chloro-4-iodophenylamino)-3,4-difluorobenzoic Acid, >95% (HPLC), 2-((2-Chloro-4-iodophenyl)amino)-3,4-difluorobenzoic acid, 97%, 97%, zapnometinib/ 99.66% (existing batch purity), Zapnometinib, Zapnometinib 97%. Offered by: TRC, Chemat, TargetMol, GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 1g, 5mg, 10mg, 200mg.
2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid (CAS 303175-44-2) is a chemical compound with the molecular formula C13H7ClF2INO2 and a molecular weight of 409.55 g/mol. IUPAC name: 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid. InChIKey: XCNBGWKQXRQKSA-UHFFFAOYSA-N.
| Molecular formula | C13H7ClF2INO2 |
|---|---|
| Molecular weight | 409.55 g/mol |
| IUPAC name | 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid |
| InChIKey | XCNBGWKQXRQKSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)Cl)NC2=C(C=CC(=C2F)F)C(=O)O |
Computed by PubChem (NCBI)