Products 3031775-57-9
CAS 3031775-57-9 is the registry number for 5-Fluoroindoline-2-carboxylic acid hydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-fluoro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride (CAS 3031775-57-9) is a chemical compound with the molecular formula C9H9ClFNO2 and a molecular weight of 217.62 g/mol. IUPAC name: 5-fluoro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride. InChIKey: GGRAUWCXBQHSRD-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFNO2 |
|---|---|
| Molecular weight | 217.62 g/mol |
| IUPAC name | 5-fluoro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride |
| InChIKey | GGRAUWCXBQHSRD-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C1C=C(C=C2)F)C(=O)O.Cl |
Computed by PubChem (NCBI)