Products 3031805-25-8

CAS 3031805-25-8 is the registry number for N1-Cbz-N2-methyl-N1-[2-(methylamino)ethyl]ethane-1,2-diamine Dihydrochloride, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 5g.

Structural formula: {0} (CAS {1})

Benzyl N,N-bis[2-(methylamino)ethyl]carbamate;dihydrochloride (CAS 3031805-25-8) is a chemical compound with the molecular formula C14H25Cl2N3O2 and a molecular weight of 338.3 g/mol. IUPAC name: benzyl N,N-bis[2-(methylamino)ethyl]carbamate;dihydrochloride. InChIKey: ACCCVOWOPBZJQD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H25Cl2N3O2
Molecular weight338.3 g/mol
IUPAC namebenzyl N,N-bis[2-(methylamino)ethyl]carbamate;dihydrochloride
InChIKeyACCCVOWOPBZJQD-UHFFFAOYSA-N
SMILESCNCCN(CCNC)C(=O)OCC1=CC=CC=C1.Cl.Cl

Computed by PubChem (NCBI)