CAS 3032-10-8 is the registry number for Betaine Methyl Ester Chloride. Offered by: Mikromol. Available pack sizes: 25mg.
(2-methoxy-2-oxoethyl)-trimethylazanium chloride (CAS 3032-10-8) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 167.63 g/mol. IUPAC name: (2-methoxy-2-oxoethyl)-trimethylazanium chloride. InChIKey: OSLWYMJLUIYBIG-UHFFFAOYSA-M.
| Molecular formula | C6H14ClNO2 |
|---|---|
| Molecular weight | 167.63 g/mol |
| IUPAC name | (2-methoxy-2-oxoethyl)-trimethylazanium chloride |
| InChIKey | OSLWYMJLUIYBIG-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC(=O)OC.[Cl-] |
Computed by PubChem (NCBI)