Products 3032026-53-9
CAS 3032026-53-9 is the registry number for (R)-N-(2-hydroxy-2-phenylethyl)-N-(4-nitrophenethyl)nitrous amide. Offered by: TRC. Available pack sizes: 25mg.
N-[(2R)-2-hydroxy-2-phenylethyl]-N-[2-(4-nitrophenyl)ethyl]nitrous amide (CAS 3032026-53-9) is a chemical compound with the molecular formula C16H17N3O4 and a molecular weight of 315.32 g/mol. IUPAC name: N-[(2R)-2-hydroxy-2-phenylethyl]-N-[2-(4-nitrophenyl)ethyl]nitrous amide. InChIKey: RTPCNTRWAROSHK-INIZCTEOSA-N.
| Molecular formula | C16H17N3O4 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | N-[(2R)-2-hydroxy-2-phenylethyl]-N-[2-(4-nitrophenyl)ethyl]nitrous amide |
| InChIKey | RTPCNTRWAROSHK-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CN(CCC2=CC=C(C=C2)[N+](=O)[O-])N=O)O |
Computed by PubChem (NCBI)