Products 3032196-88-3

CAS 3032196-88-3 is the registry number for TEAD-IN-11, 99.82%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 50 mg, 5 mg.

Structural formula: {0} (CAS {1})

1-[3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidin-1-yl]prop-2-en-1-one (CAS 3032196-88-3) is a chemical compound with the molecular formula C16H14F3NO and a molecular weight of 293.28 g/mol. IUPAC name: 1-[3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidin-1-yl]prop-2-en-1-one. InChIKey: SMWFYQNFFUAYFF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14F3NO
Molecular weight293.28 g/mol
IUPAC name1-[3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidin-1-yl]prop-2-en-1-one
InChIKeySMWFYQNFFUAYFF-UHFFFAOYSA-N
SMILESC=CC(=O)N1CCC(C1)C#CC2=CC=C(C=C2)C(F)(F)F

Computed by PubChem (NCBI)

Synonyms: orb2564709