CAS 3032196-88-3 is the registry number for TEAD-IN-11, 99.82%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 50 mg, 5 mg.
1-[3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidin-1-yl]prop-2-en-1-one (CAS 3032196-88-3) is a chemical compound with the molecular formula C16H14F3NO and a molecular weight of 293.28 g/mol. IUPAC name: 1-[3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidin-1-yl]prop-2-en-1-one. InChIKey: SMWFYQNFFUAYFF-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NO |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | 1-[3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidin-1-yl]prop-2-en-1-one |
| InChIKey | SMWFYQNFFUAYFF-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N1CCC(C1)C#CC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)