Products 3032232-47-3
CAS 3032232-47-3 appears in our catalog under these names: TLX agonist 3, TLX agonist 10, 95%. Offered by: MedChemExpress, Ambeed. Available pack sizes: Get quote, 1mg, 5mg, 10mg, 25mg, 50mg.
2-butoxy-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]quinoline-4-carboxamide (CAS 3032232-47-3) is a chemical compound with the molecular formula C25H23F3N4O2 and a molecular weight of 468.5 g/mol. IUPAC name: 2-butoxy-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]quinoline-4-carboxamide. InChIKey: RTKBIHCZDFXHLC-UHFFFAOYSA-N.
| Molecular formula | C25H23F3N4O2 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 2-butoxy-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]quinoline-4-carboxamide |
| InChIKey | RTKBIHCZDFXHLC-UHFFFAOYSA-N |
| SMILES | CCCCOC1=NC2=CC=CC=C2C(=C1)C(=O)NC3=CC(=CC(=C3)C(F)(F)F)N4C=C(N=C4)C |
Computed by PubChem (NCBI)