Products 3032275-33-2

CAS 3032275-33-2 is the registry number for LPAR1 antagonist 1, 98.85%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 10 mg, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

4-[4-[(2-methoxy-4-methylphenyl)carbamoyl]-4-(2-propan-2-ylphenyl)piperidin-1-yl]-4-oxobutanoic acid (CAS 3032275-33-2) is a chemical compound with the molecular formula C27H34N2O5 and a molecular weight of 466.6 g/mol. IUPAC name: 4-[4-[(2-methoxy-4-methylphenyl)carbamoyl]-4-(2-propan-2-ylphenyl)piperidin-1-yl]-4-oxobutanoic acid. InChIKey: XXIOBZYOOQRDDS-UHFFFAOYSA-N.

Identity
Molecular formulaC27H34N2O5
Molecular weight466.6 g/mol
IUPAC name4-[4-[(2-methoxy-4-methylphenyl)carbamoyl]-4-(2-propan-2-ylphenyl)piperidin-1-yl]-4-oxobutanoic acid
InChIKeyXXIOBZYOOQRDDS-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)NC(=O)C2(CCN(CC2)C(=O)CCC(=O)O)C3=CC=CC=C3C(C)C)OC

Computed by PubChem (NCBI)