Products 3032401-50-3
CAS 3032401-50-3 is the registry number for Dyrk1A/B-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-[(2-aminophenyl)methylcarbamoyl]thiophen-2-yl]-1-benzothiophene-2-carboxamide (CAS 3032401-50-3) is a chemical compound with the molecular formula C21H17N3O2S2 and a molecular weight of 407.5 g/mol. IUPAC name: 4-[5-[(2-aminophenyl)methylcarbamoyl]thiophen-2-yl]-1-benzothiophene-2-carboxamide. InChIKey: UQZFCZAYARDQIK-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O2S2 |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | 4-[5-[(2-aminophenyl)methylcarbamoyl]thiophen-2-yl]-1-benzothiophene-2-carboxamide |
| InChIKey | UQZFCZAYARDQIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(=O)C2=CC=C(S2)C3=C4C=C(SC4=CC=C3)C(=O)N)N |
Computed by PubChem (NCBI)