Products 3032446-53-7
CAS 3032446-53-7 is the registry number for TrxR-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,2-dichloro-N-[4-(1,3,2-dithiarsinan-2-yl)phenyl]acetamide (CAS 3032446-53-7) is a chemical compound with the molecular formula C11H12AsCl2NOS2 and a molecular weight of 384.2 g/mol. IUPAC name: 2,2-dichloro-N-[4-(1,3,2-dithiarsinan-2-yl)phenyl]acetamide. InChIKey: BNFHKOYMQVMSQZ-UHFFFAOYSA-N.
| Molecular formula | C11H12AsCl2NOS2 |
|---|---|
| Molecular weight | 384.2 g/mol |
| IUPAC name | 2,2-dichloro-N-[4-(1,3,2-dithiarsinan-2-yl)phenyl]acetamide |
| InChIKey | BNFHKOYMQVMSQZ-UHFFFAOYSA-N |
| SMILES | C1CS[As](SC1)C2=CC=C(C=C2)NC(=O)C(Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
TrxR-IN-6, orb3132800