Products 3032485-62-1
CAS 3032485-62-1 is the registry number for Antifungal agent 72. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-[5-[2-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-5-yl]-1,3,4-oxadiazol-2-yl]ethane-1,2-diamine (CAS 3032485-62-1) is a chemical compound with the molecular formula C18H23N5OS and a molecular weight of 357.5 g/mol. IUPAC name: N'-[5-[2-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-5-yl]-1,3,4-oxadiazol-2-yl]ethane-1,2-diamine. InChIKey: WGLFIVVPESNTEX-UHFFFAOYSA-N.
| Molecular formula | C18H23N5OS |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | N'-[5-[2-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-5-yl]-1,3,4-oxadiazol-2-yl]ethane-1,2-diamine |
| InChIKey | WGLFIVVPESNTEX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=C(C=C2)C(C)(C)C)C3=NN=C(O3)NCCN |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 27