Products 3032601-04-7
CAS 3032601-04-7 is the registry number for BRD7-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-(6-methoxy-2-methyl-3-pyridinyl)-1,4-dimethylquinolin-2-one (CAS 3032601-04-7) is a chemical compound with the molecular formula C18H18N2O2 and a molecular weight of 294.3 g/mol. IUPAC name: 7-(6-methoxy-2-methyl-3-pyridinyl)-1,4-dimethylquinolin-2-one. InChIKey: NIKNWIMZQISDHR-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O2 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 7-(6-methoxy-2-methyl-3-pyridinyl)-1,4-dimethylquinolin-2-one |
| InChIKey | NIKNWIMZQISDHR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C2=C1C=CC(=C2)C3=C(N=C(C=C3)OC)C)C |
Computed by PubChem (NCBI)