Products 3032604-29-5
CAS 3032604-29-5 is the registry number for SARS-CoV-2 3CLpro-IN-18. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] thiocyanate (CAS 3032604-29-5) is a chemical compound with the molecular formula C17H13ClN2OS and a molecular weight of 328.8 g/mol. IUPAC name: [2-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] thiocyanate. InChIKey: AHGIFHCAUNNLPO-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2OS |
|---|---|
| Molecular weight | 328.8 g/mol |
| IUPAC name | [2-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] thiocyanate |
| InChIKey | AHGIFHCAUNNLPO-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C3=C1C=CC(=C3)Cl)C(=O)CSC#N |
Computed by PubChem (NCBI)
Synonyms:
SARS-CoV-2 3CLpro-IN-18