Products 3032604-33-1
CAS 3032604-33-1 is the registry number for SARS-CoV-2 3CLpro-IN-17. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(2-cyanophenothiazin-10-yl)-2-oxoethyl] thiocyanate (CAS 3032604-33-1) is a chemical compound with the molecular formula C16H9N3OS2 and a molecular weight of 323.4 g/mol. IUPAC name: [2-(2-cyanophenothiazin-10-yl)-2-oxoethyl] thiocyanate. InChIKey: GHDYRHSJOHGBSB-UHFFFAOYSA-N.
| Molecular formula | C16H9N3OS2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | [2-(2-cyanophenothiazin-10-yl)-2-oxoethyl] thiocyanate |
| InChIKey | GHDYRHSJOHGBSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=C(S2)C=CC(=C3)C#N)C(=O)CSC#N |
Computed by PubChem (NCBI)
Synonyms:
SARS-CoV-2 3CLpro-IN-17