Products 3032965-02-6
CAS 3032965-02-6 is the registry number for ERRα antagonist-2, 99.07%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 25 mg, 10 mg, 5 mg.
N-[2-(4-methoxyphenoxy)phenyl]-4-nitrobenzenesulfonamide (CAS 3032965-02-6) is a chemical compound with the molecular formula C19H16N2O6S and a molecular weight of 400.4 g/mol. IUPAC name: N-[2-(4-methoxyphenoxy)phenyl]-4-nitrobenzenesulfonamide. InChIKey: UKNRMXHVSQSYPP-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O6S |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | N-[2-(4-methoxyphenoxy)phenyl]-4-nitrobenzenesulfonamide |
| InChIKey | UKNRMXHVSQSYPP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=CC=CC=C2NS(=O)(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)