Products 3033032-03-7
CAS 3033032-03-7 is the registry number for J27644. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
4-[(8-chloro-2,4-dioxoquinazolin-1-yl)methyl]-N-hydroxybenzamide (CAS 3033032-03-7) is a chemical compound with the molecular formula C16H12ClN3O4 and a molecular weight of 345.73 g/mol. IUPAC name: 4-[(8-chloro-2,4-dioxoquinazolin-1-yl)methyl]-N-hydroxybenzamide. InChIKey: OWMZGLVMABQUAQ-UHFFFAOYSA-N.
| Molecular formula | C16H12ClN3O4 |
|---|---|
| Molecular weight | 345.73 g/mol |
| IUPAC name | 4-[(8-chloro-2,4-dioxoquinazolin-1-yl)methyl]-N-hydroxybenzamide |
| InChIKey | OWMZGLVMABQUAQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N(C(=O)NC2=O)CC3=CC=C(C=C3)C(=O)NO |
Computed by PubChem (NCBI)