Products 3033042-50-8
CAS 3033042-50-8 is the registry number for Carbonic anhydrase inhibitor 9. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-bromophenyl)-2-[2-hydroxy-3-[(4-sulfamoylphenyl)diazenyl]indol-1-yl]acetamide (CAS 3033042-50-8) is a chemical compound with the molecular formula C22H18BrN5O4S and a molecular weight of 528.4 g/mol. IUPAC name: N-(4-bromophenyl)-2-[2-hydroxy-3-[(4-sulfamoylphenyl)diazenyl]indol-1-yl]acetamide. InChIKey: NQQTVZAMMQYXBZ-UHFFFAOYSA-N.
| Molecular formula | C22H18BrN5O4S |
|---|---|
| Molecular weight | 528.4 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-[2-hydroxy-3-[(4-sulfamoylphenyl)diazenyl]indol-1-yl]acetamide |
| InChIKey | NQQTVZAMMQYXBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2CC(=O)NC3=CC=C(C=C3)Br)O)N=NC4=CC=C(C=C4)S(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
Carbonic anhydrase inhibitor 9