CAS 30331-75-0 appears in our catalog under these names: Escholamine iodide, 95%, Escholamine iodide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 1mg.
5-(1,3-benzodioxol-5-ylmethyl)-6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide (CAS 30331-75-0) is a chemical compound with the molecular formula C19H16INO4 and a molecular weight of 449.2 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-ylmethyl)-6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide. InChIKey: UYBIHBWVGXQEJG-UHFFFAOYSA-M.
| Molecular formula | C19H16INO4 |
|---|---|
| Molecular weight | 449.2 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-ylmethyl)-6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide |
| InChIKey | UYBIHBWVGXQEJG-UHFFFAOYSA-M |
| SMILES | C[N+]1=C(C2=CC3=C(C=C2C=C1)OCO3)CC4=CC5=C(C=C4)OCO5.[I-] |
Computed by PubChem (NCBI)