Products 3033281-96-5
CAS 3033281-96-5 is the registry number for AhR agonist 6. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-fluoro-5-[(E)-2-(2-fluorophenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol (CAS 3033281-96-5) is a chemical compound with the molecular formula C17H16F2O2 and a molecular weight of 290.30 g/mol. IUPAC name: 4-fluoro-5-[(E)-2-(2-fluorophenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol. InChIKey: WIRZVQAWDLZEFE-BQYQJAHWSA-N.
| Molecular formula | C17H16F2O2 |
|---|---|
| Molecular weight | 290.30 g/mol |
| IUPAC name | 4-fluoro-5-[(E)-2-(2-fluorophenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol |
| InChIKey | WIRZVQAWDLZEFE-BQYQJAHWSA-N |
| SMILES | CC(C)C1=C(C=C(C(=C1O)F)/C=C/C2=CC=CC=C2F)O |
Computed by PubChem (NCBI)
Synonyms:
AhR agonist 6, orb2567066