Products 3033374-40-9
CAS 3033374-40-9 is the registry number for Carbonic anhydrase inhibitor 19. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3-[[benzenesulfonyl-[2-(4-sulfamoylphenyl)ethyl]amino]methyl]anilino]acetic acid (CAS 3033374-40-9) is a chemical compound with the molecular formula C23H25N3O6S2 and a molecular weight of 503.6 g/mol. IUPAC name: 2-[3-[[benzenesulfonyl-[2-(4-sulfamoylphenyl)ethyl]amino]methyl]anilino]acetic acid. InChIKey: PXERSONYQKALBK-UHFFFAOYSA-N.
| Molecular formula | C23H25N3O6S2 |
|---|---|
| Molecular weight | 503.6 g/mol |
| IUPAC name | 2-[3-[[benzenesulfonyl-[2-(4-sulfamoylphenyl)ethyl]amino]methyl]anilino]acetic acid |
| InChIKey | PXERSONYQKALBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N(CCC2=CC=C(C=C2)S(=O)(=O)N)CC3=CC(=CC=C3)NCC(=O)O |
Computed by PubChem (NCBI)