CAS 3033592-44-5 is the registry number for SMARCA2 ligand-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-7,7-dimethyl-10-piperidin-4-ylindolo[1,2-a]quinazolin-5-one (CAS 3033592-44-5) is a chemical compound with the molecular formula C22H22ClN3O and a molecular weight of 379.9 g/mol. IUPAC name: 4-chloro-7,7-dimethyl-10-piperidin-4-ylindolo[1,2-a]quinazolin-5-one. InChIKey: DILRMESFNBVNMG-UHFFFAOYSA-N.
| Molecular formula | C22H22ClN3O |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | 4-chloro-7,7-dimethyl-10-piperidin-4-ylindolo[1,2-a]quinazolin-5-one |
| InChIKey | DILRMESFNBVNMG-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)C3CCNCC3)N4C1=NC(=O)C5=C4C=CC=C5Cl)C |
Computed by PubChem (NCBI)