Products 3033746-27-6

CAS 3033746-27-6 is the registry number for STAT3-IN-26, 96.84%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 10 mg, 100 mg, 5 mg.

Structural formula: {0} (CAS {1})

4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid (CAS 3033746-27-6) is a chemical compound with the molecular formula C16H11F5N2O5S and a molecular weight of 438.3 g/mol. IUPAC name: 4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid. InChIKey: OCIJQEBSIRWRHX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11F5N2O5S
Molecular weight438.3 g/mol
IUPAC name4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid
InChIKeyOCIJQEBSIRWRHX-UHFFFAOYSA-N
SMILESCN(CC(=O)NC1=CC=C(C=C1)C(=O)O)S(=O)(=O)C2=C(C(=C(C(=C2F)F)F)F)F

Computed by PubChem (NCBI)

Synonyms: orb2565246