CAS 3033746-27-6 is the registry number for STAT3-IN-26, 96.84%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 10 mg, 100 mg, 5 mg.
4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid (CAS 3033746-27-6) is a chemical compound with the molecular formula C16H11F5N2O5S and a molecular weight of 438.3 g/mol. IUPAC name: 4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid. InChIKey: OCIJQEBSIRWRHX-UHFFFAOYSA-N.
| Molecular formula | C16H11F5N2O5S |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | 4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid |
| InChIKey | OCIJQEBSIRWRHX-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)NC1=CC=C(C=C1)C(=O)O)S(=O)(=O)C2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)