Products 3033875-32-7
CAS 3033875-32-7 is the registry number for Nurr1 agonist 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-N-[5-chloro-2-[2-(dimethylamino)ethoxy]phenyl]-1H-indole-6-carboxamide (CAS 3033875-32-7) is a chemical compound with the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.3 g/mol. IUPAC name: 5-chloro-N-[5-chloro-2-[2-(dimethylamino)ethoxy]phenyl]-1H-indole-6-carboxamide. InChIKey: LWEDOMJYGSQEGS-UHFFFAOYSA-N.
| Molecular formula | C19H19Cl2N3O2 |
|---|---|
| Molecular weight | 392.3 g/mol |
| IUPAC name | 5-chloro-N-[5-chloro-2-[2-(dimethylamino)ethoxy]phenyl]-1H-indole-6-carboxamide |
| InChIKey | LWEDOMJYGSQEGS-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC1=C(C=C(C=C1)Cl)NC(=O)C2=C(C=C3C=CNC3=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
Nurr1 agonist 5