CAS 3034-49-9 appears in our catalog under these names: 5-Nitrothiazol-2(3H)-one, 98%, 5-Nitro-2,3-dihydro-1,3-thiazol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-nitro-3H-1,3-thiazol-2-one (CAS 3034-49-9) is a chemical compound with the molecular formula C3H2N2O3S and a molecular weight of 146.13 g/mol. IUPAC name: 5-nitro-3H-1,3-thiazol-2-one. InChIKey: YZFUZYHYTMCBDT-UHFFFAOYSA-N.
| Molecular formula | C3H2N2O3S |
|---|---|
| Molecular weight | 146.13 g/mol |
| IUPAC name | 5-nitro-3H-1,3-thiazol-2-one |
| InChIKey | YZFUZYHYTMCBDT-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)