Products 3034181-88-6
CAS 3034181-88-6 is the registry number for Z795161988. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(4-bromoanilino)-2-oxoethyl] 3-(furan-3-yl)-1H-pyrazole-5-carboxylate (CAS 3034181-88-6) is a chemical compound with the molecular formula C16H12BrN3O4 and a molecular weight of 390.19 g/mol. IUPAC name: [2-(4-bromoanilino)-2-oxoethyl] 3-(furan-3-yl)-1H-pyrazole-5-carboxylate. InChIKey: ANPNOSKPPVUFTH-UHFFFAOYSA-N.
| Molecular formula | C16H12BrN3O4 |
|---|---|
| Molecular weight | 390.19 g/mol |
| IUPAC name | [2-(4-bromoanilino)-2-oxoethyl] 3-(furan-3-yl)-1H-pyrazole-5-carboxylate |
| InChIKey | ANPNOSKPPVUFTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)COC(=O)C2=CC(=NN2)C3=COC=C3)Br |
Computed by PubChem (NCBI)