CAS 3034402-33-7 is the registry number for Antibacterial agent 221. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]-4-(trifluoromethyl)benzamide (CAS 3034402-33-7) is a chemical compound with the molecular formula C25H20F3N3O and a molecular weight of 435.4 g/mol. IUPAC name: N-[4-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]-4-(trifluoromethyl)benzamide. InChIKey: KUNKDWOQUJHHBX-UHFFFAOYSA-N.
| Molecular formula | C25H20F3N3O |
|---|---|
| Molecular weight | 435.4 g/mol |
| IUPAC name | N-[4-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]-4-(trifluoromethyl)benzamide |
| InChIKey | KUNKDWOQUJHHBX-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C3=CC=CC=C3N2)C4=CC=C(C=C4)NC(=O)C5=CC=C(C=C5)C(F)(F)F |
Computed by PubChem (NCBI)