CAS 3034488-42-8 is the registry number for HIF-2α-IN-13. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3-chloro-4,5-difluorophenyl)-(3,3-difluoro-4-hydroxy-1-azaspiro[4.4]nonan-1-yl)methanone (CAS 3034488-42-8) is a chemical compound with the molecular formula C15H14ClF4NO2 and a molecular weight of 351.72 g/mol. IUPAC name: (3-chloro-4,5-difluorophenyl)-(3,3-difluoro-4-hydroxy-1-azaspiro[4.4]nonan-1-yl)methanone. InChIKey: MCKSVUYTYTWRGF-UHFFFAOYSA-N.
| Molecular formula | C15H14ClF4NO2 |
|---|---|
| Molecular weight | 351.72 g/mol |
| IUPAC name | (3-chloro-4,5-difluorophenyl)-(3,3-difluoro-4-hydroxy-1-azaspiro[4.4]nonan-1-yl)methanone |
| InChIKey | MCKSVUYTYTWRGF-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(C(CN2C(=O)C3=CC(=C(C(=C3)Cl)F)F)(F)F)O |
Computed by PubChem (NCBI)