CAS 3034834-45-9 is the registry number for GID4-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[3-(2-bromo-3-fluorophenyl)piperazin-1-yl]-6-propan-2-ylpyrimidin-2-amine (CAS 3034834-45-9) is a chemical compound with the molecular formula C17H21BrFN5 and a molecular weight of 394.3 g/mol. IUPAC name: 4-[3-(2-bromo-3-fluorophenyl)piperazin-1-yl]-6-propan-2-ylpyrimidin-2-amine. InChIKey: GOCQQNWAYQJFNH-UHFFFAOYSA-N.
| Molecular formula | C17H21BrFN5 |
|---|---|
| Molecular weight | 394.3 g/mol |
| IUPAC name | 4-[3-(2-bromo-3-fluorophenyl)piperazin-1-yl]-6-propan-2-ylpyrimidin-2-amine |
| InChIKey | GOCQQNWAYQJFNH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=NC(=N1)N)N2CCNC(C2)C3=C(C(=CC=C3)F)Br |
Computed by PubChem (NCBI)