Products 3034880-93-5
CAS 3034880-93-5 appears in our catalog under these names: (R)-1-(3-(3-(4-Aminopyrimidin-2-yl)-5-chlorophenyl)morpholino)prop-2-en-1-one, VVD-130037, 99.91%, VVD-130037, 98%. Offered by: Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 10mM/1mL, 25 mg.
1-[(3R)-3-[3-(4-aminopyrimidin-2-yl)-5-chlorophenyl]morpholin-4-yl]prop-2-en-1-one (CAS 3034880-93-5) is a chemical compound with the molecular formula C17H17ClN4O2 and a molecular weight of 344.8 g/mol. IUPAC name: 1-[(3R)-3-[3-(4-aminopyrimidin-2-yl)-5-chlorophenyl]morpholin-4-yl]prop-2-en-1-one. InChIKey: IRLNMPCPLJZIGO-AWEZNQCLSA-N.
| Molecular formula | C17H17ClN4O2 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | 1-[(3R)-3-[3-(4-aminopyrimidin-2-yl)-5-chlorophenyl]morpholin-4-yl]prop-2-en-1-one |
| InChIKey | IRLNMPCPLJZIGO-AWEZNQCLSA-N |
| SMILES | C=CC(=O)N1CCOC[C@H]1C2=CC(=CC(=C2)C3=NC=CC(=N3)N)Cl |
Computed by PubChem (NCBI)