Products 3034996-30-7
CAS 3034996-30-7 is the registry number for 4,6-dichloro-2-(trifluoromethyl)nicotinonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,6-dichloro-2-(trifluoromethyl)pyridine-3-carbonitrile (CAS 3034996-30-7) is a chemical compound with the molecular formula C7HCl2F3N2 and a molecular weight of 240.99 g/mol. IUPAC name: 4,6-dichloro-2-(trifluoromethyl)pyridine-3-carbonitrile. InChIKey: SUIFMGWHOQJPJT-UHFFFAOYSA-N.
| Molecular formula | C7HCl2F3N2 |
|---|---|
| Molecular weight | 240.99 g/mol |
| IUPAC name | 4,6-dichloro-2-(trifluoromethyl)pyridine-3-carbonitrile |
| InChIKey | SUIFMGWHOQJPJT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)C(F)(F)F)C#N)Cl |
Computed by PubChem (NCBI)