CAS 3035000-69-9 is the registry number for HSD17B13 degrader 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[[4-(6-chloroindazol-2-yl)cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide (CAS 3035000-69-9) is a chemical compound with the molecular formula C21H19ClF3N3O2 and a molecular weight of 437.8 g/mol. IUPAC name: N-[[4-(6-chloroindazol-2-yl)cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide. InChIKey: VIWCQDMYRZNNBU-UHFFFAOYSA-N.
| Molecular formula | C21H19ClF3N3O2 |
|---|---|
| Molecular weight | 437.8 g/mol |
| IUPAC name | N-[[4-(6-chloroindazol-2-yl)cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide |
| InChIKey | VIWCQDMYRZNNBU-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CNC(=O)C2=CC(=C(C(=C2F)F)O)F)N3C=C4C=CC(=CC4=N3)Cl |
Computed by PubChem (NCBI)