CAS 3035217-26-3 is the registry number for E3 Ligase Ligand-linker Conjugate 180. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]methyl]benzoic acid (CAS 3035217-26-3) is a chemical compound with the molecular formula C25H26N4O5 and a molecular weight of 462.5 g/mol. IUPAC name: 4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]methyl]benzoic acid. InChIKey: FWJIHKRGLGDZLQ-UHFFFAOYSA-N.
| Molecular formula | C25H26N4O5 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | 4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]methyl]benzoic acid |
| InChIKey | FWJIHKRGLGDZLQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)N4CCN(CC4)CC5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)