Products 3035297-25-4
CAS 3035297-25-4 appears in our catalog under these names: 4-[3-(Trifluoromethyl)-3H-diazirin-3-yl]benzyl Methacrylate (stabilized with MEHQ), >95.0%(HPLC)(qNMR), 4-(3-(Trifluoromethyl)-3H-diazirin-3-yl)benzyl methacrylate, 95.0%. Offered by: TCI, Chemat. Available pack sizes: 250mg, 1g.
[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl 2-methylprop-2-enoate (CAS 3035297-25-4) is a chemical compound with the molecular formula C13H11F3N2O2 and a molecular weight of 284.23 g/mol. IUPAC name: [4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl 2-methylprop-2-enoate. InChIKey: CIRXFXAKXOSTFM-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | [4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl 2-methylprop-2-enoate |
| InChIKey | CIRXFXAKXOSTFM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC1=CC=C(C=C1)C2(N=N2)C(F)(F)F |
Computed by PubChem (NCBI)