CAS 30361-43-4 is the registry number for Cephalosporin C analog-1 (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
CAS 30361-43-4 identifies a chemical compound with the molecular formula C15H14N2NaO6S2 and a molecular weight of 405.4 g/mol. InChIKey: FTLUKXJBNAYQNG-GBWFEORMSA-N.
| Molecular formula | C15H14N2NaO6S2 |
|---|---|
| Molecular weight | 405.4 g/mol |
| InChIKey | FTLUKXJBNAYQNG-GBWFEORMSA-N |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CS3)C(=O)O)COC=O.[Na] |
Computed by PubChem (NCBI)