Products 3036109-10-8

CAS 3036109-10-8 is the registry number for SDU-071, 98.75%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

2-[(4-methoxyanilino)methyl]-N-(4-methoxyphenyl)benzo[h]quinolin-4-amine (CAS 3036109-10-8) is a chemical compound with the molecular formula C28H25N3O2 and a molecular weight of 435.5 g/mol. IUPAC name: 2-[(4-methoxyanilino)methyl]-N-(4-methoxyphenyl)benzo[h]quinolin-4-amine. InChIKey: ZWWQETFJXKSVFP-UHFFFAOYSA-N.

Identity
Molecular formulaC28H25N3O2
Molecular weight435.5 g/mol
IUPAC name2-[(4-methoxyanilino)methyl]-N-(4-methoxyphenyl)benzo[h]quinolin-4-amine
InChIKeyZWWQETFJXKSVFP-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)NCC2=CC(=C3C=CC4=CC=CC=C4C3=N2)NC5=CC=C(C=C5)OC

Computed by PubChem (NCBI)