CAS 3036136-18-9 is the registry number for hCAI/II-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 4-(dimethylamino)benzoate (CAS 3036136-18-9) is a chemical compound with the molecular formula C22H20N4O3 and a molecular weight of 388.4 g/mol. IUPAC name: [4-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 4-(dimethylamino)benzoate. InChIKey: HJTMMGXVJSCVTR-UHFFFAOYSA-N.
| Molecular formula | C22H20N4O3 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | [4-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 4-(dimethylamino)benzoate |
| InChIKey | HJTMMGXVJSCVTR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)C=NNC(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)