CAS 3036136-22-5 is the registry number for AChE/BChE-IN-19. Offered by: MedChemExpress. Available pack sizes: Get quote.
[1-[(E)-(pyridine-3-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 4-(dimethylamino)benzoate (CAS 3036136-22-5) is a chemical compound with the molecular formula C26H22N4O3 and a molecular weight of 438.5 g/mol. IUPAC name: [1-[(E)-(pyridine-3-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 4-(dimethylamino)benzoate. InChIKey: KEOOXIGLSOTSCF-OGLMXYFKSA-N.
| Molecular formula | C26H22N4O3 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | [1-[(E)-(pyridine-3-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 4-(dimethylamino)benzoate |
| InChIKey | KEOOXIGLSOTSCF-OGLMXYFKSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)OC2=C(C3=CC=CC=C3C=C2)/C=N/NC(=O)C4=CN=CC=C4 |
Computed by PubChem (NCBI)