CAS 3036158-95-6 is the registry number for PNPLA3 modifier 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-chlorophenyl) (5R)-5-(1,1-dioxothiazinan-2-yl)-3,3-difluoropiperidine-1-carboxylate (CAS 3036158-95-6) is a chemical compound with the molecular formula C16H19ClF2N2O4S and a molecular weight of 408.8 g/mol. IUPAC name: (4-chlorophenyl) (5R)-5-(1,1-dioxothiazinan-2-yl)-3,3-difluoropiperidine-1-carboxylate. InChIKey: ZBDZZTVKBGVOPB-CYBMUJFWSA-N.
| Molecular formula | C16H19ClF2N2O4S |
|---|---|
| Molecular weight | 408.8 g/mol |
| IUPAC name | (4-chlorophenyl) (5R)-5-(1,1-dioxothiazinan-2-yl)-3,3-difluoropiperidine-1-carboxylate |
| InChIKey | ZBDZZTVKBGVOPB-CYBMUJFWSA-N |
| SMILES | C1CCS(=O)(=O)N(C1)[C@@H]2CC(CN(C2)C(=O)OC3=CC=C(C=C3)Cl)(F)F |
Computed by PubChem (NCBI)