Products 3036509-59-5
CAS 3036509-59-5 is the registry number for 2-(4'-chloro-[1,1':2',1''-terphenyl]-2-yl)-4,6-diphenyl-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[2-(4-chloro-2-phenylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine (CAS 3036509-59-5) is a chemical compound with the molecular formula C33H22ClN3 and a molecular weight of 496.0 g/mol. IUPAC name: 2-[2-(4-chloro-2-phenylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine. InChIKey: VJSCSONFKADMNP-UHFFFAOYSA-N.
| Molecular formula | C33H22ClN3 |
|---|---|
| Molecular weight | 496.0 g/mol |
| IUPAC name | 2-[2-(4-chloro-2-phenylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| InChIKey | VJSCSONFKADMNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)Cl)C3=CC=CC=C3C4=NC(=NC(=N4)C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)