CAS 2450449-48-4 is the registry number for 2,4-Di([1,1'-biphenyl]-2-yl)-6-(3-chlorophenyl)-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)-4,6-bis(2-phenylphenyl)-1,3,5-triazine (CAS 2450449-48-4) is a chemical compound with the molecular formula C33H22ClN3 and a molecular weight of 496.0 g/mol. IUPAC name: 2-(3-chlorophenyl)-4,6-bis(2-phenylphenyl)-1,3,5-triazine. InChIKey: PYFLGAKAJDZZSX-UHFFFAOYSA-N.
| Molecular formula | C33H22ClN3 |
|---|---|
| Molecular weight | 496.0 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-4,6-bis(2-phenylphenyl)-1,3,5-triazine |
| InChIKey | PYFLGAKAJDZZSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=NC(=NC(=N3)C4=CC(=CC=C4)Cl)C5=CC=CC=C5C6=CC=CC=C6 |
Computed by PubChem (NCBI)